C18H27Cl3O4 — CID 173134623
[(2R,4aS,5S,8R,8aR)-8a-hydroxy-3,8-dimethyl-5-propan-2-yl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] 2,2,2-trichloroethyl carbonate (PubChem CID 173134623) has the molecular formula C18H27Cl3O4 and a molecular weight of 413.77 g/mol. Its IUPAC name is [(2R,4aS,5S,8R,8aR)-8a-hydroxy-3,8-dimethyl-5-propan-2-yl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] 2,2,2-trichloroethyl carbonate.
| Compound Name | [(2R,4aS,5S,8R,8aR)-8a-hydroxy-3,8-dimethyl-5-propan-2-yl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] 2,2,2-trichloroethyl carbonate |
|---|---|
| PubChem CID | 173134623 |
| Molecular Formula | C18H27Cl3O4 |
| Molecular Weight | 413.77 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | [(2R,4aS,5S,8R,8aR)-8a-hydroxy-3,8-dimethyl-5-propan-2-yl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] 2,2,2-trichloroethyl carbonate |
| SMILES | CC1=C[C@@H]2[C@H](C(C)C)CC[C@@H](C)[C@]2(O)C[C@H]1OC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H27Cl3O4/c1-10(2)13-6-5-12(4)17(23)8-15(11(3)7-14(13)17)25-16(22)24-9-18(19,20)21/h7,10,12-15,23H,5-6,8-9H2,1-4H3/t12-,13+,14-,15-,17-/m1/s1 |
| InChIKey | QKGJJXUMJTVUHS-JRBZFYFNSA-N |
| XLogP | 5.28 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.77 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|