C23H27N7O3 — CID 173135107
6-[1-[1-(cyclohexylmethylamino)-2-nitroethenyl]azetidin-3-yl]-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 173135107) has the molecular formula C23H27N7O3 and a molecular weight of 449.52 g/mol. Its IUPAC name is 6-[1-[1-(cyclohexylmethylamino)-2-nitroethenyl]azetidin-3-yl]-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 6-[1-[1-(cyclohexylmethylamino)-2-nitroethenyl]azetidin-3-yl]-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 173135107 |
| Molecular Formula | C23H27N7O3 |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 6-[1-[1-(cyclohexylmethylamino)-2-nitroethenyl]azetidin-3-yl]-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(C2CN(C(=C[N+](=O)[O-])NCC3CCCCC3)C2)nc2c1cnn2-c1ccccc1 |
| InChI | InChI=1S/C23H27N7O3/c31-23-19-12-25-30(18-9-5-2-6-10-18)22(19)26-21(27-23)17-13-28(14-17)20(15-29(32)33)24-11-16-7-3-1-4-8-16/h2,5-6,9-10,12,15-17,24H,1,3-4,7-8,11,13-14H2,(H,26,27,31) |
| InChIKey | CXCKUHCZVAQGQO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 121.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|