C9H6F5NO — CID 173135355
2,6-difluoro-3-(2,2,2-trifluoroethyl)benzamide (PubChem CID 173135355) has the molecular formula C9H6F5NO and a molecular weight of 239.14 g/mol. Its IUPAC name is 2,6-difluoro-3-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2,6-difluoro-3-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 173135355 |
| Molecular Formula | C9H6F5NO |
| Molecular Weight | 239.14 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 2,6-difluoro-3-(2,2,2-trifluoroethyl)benzamide |
| SMILES | NC(=O)c1c(F)ccc(CC(F)(F)F)c1F |
| InChI | InChI=1S/C9H6F5NO/c10-5-2-1-4(3-9(12,13)14)7(11)6(5)8(15)16/h1-2H,3H2,(H2,15,16) |
| InChIKey | AWOXKFIDQPCBSE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.14 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |