About 1-fluorobut-1-enyl formate
1-fluorobut-1-enyl formate (PubChem CID 173135525) has the molecular formula C5H7FO2
and a molecular weight of 118.11 g/mol. Its IUPAC name is 1-fluorobut-1-enyl formate.
Molecular Properties
| Compound Name | 1-fluorobut-1-enyl formate |
| PubChem CID | 173135525 |
| Molecular Formula | C5H7FO2 |
| Molecular Weight | 118.11 g/mol |
| Exact Mass | 118.04 |
| IUPAC Name | 1-fluorobut-1-enyl formate |
| SMILES | CCC=C(F)OC=O |
| InChI | InChI=1S/C5H7FO2/c1-2-3-5(6)8-4-7/h3-4H,2H2,1H3 |
| InChIKey | YVWWWGGIDXTAAY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.11 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-fluorobut-1-enyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluorobut-1-enyl formate?
The IUPAC name of 1-fluorobut-1-enyl formate (CID 173135525) is 1-fluorobut-1-enyl formate.
What is the SMILES notation for 1-fluorobut-1-enyl formate?
The canonical SMILES for 1-fluorobut-1-enyl formate is CCC=C(F)OC=O.
What is the InChIKey of 1-fluorobut-1-enyl formate?
The InChIKey is YVWWWGGIDXTAAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7FO2/c1-2-3-5(6)8-4-7/h3-4H,2H2,1H3.
What are the key properties of 1-fluorobut-1-enyl formate?
1-fluorobut-1-enyl formate has a molecular weight of 118.11 g/mol, XLogP of 1.38, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluorobut-1-enyl formate is sourced from PubChem (CID 173135525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).