About bis(dioxido(dioxo)manganese);platinum(4+)
bis(dioxido(dioxo)manganese);platinum(4+) (PubChem CID 173135552) has the molecular formula Mn2O8Pt
and a molecular weight of 432.95 g/mol. Its IUPAC name is bis(dioxido(dioxo)manganese);platinum(4+).
Molecular Properties
| Compound Name | bis(dioxido(dioxo)manganese);platinum(4+) |
| PubChem CID | 173135552 |
| Molecular Formula | Mn2O8Pt |
| Molecular Weight | 432.95 g/mol |
| Exact Mass | 432.80 |
| IUPAC Name | bis(dioxido(dioxo)manganese);platinum(4+) |
| SMILES | O=[Mn](=O)([O-])[O-].O=[Mn](=O)([O-])[O-].[Pt+4] |
| InChI | InChI=1S/2Mn.8O.Pt/q;;;;;;4*-1;+4 |
| InChIKey | GWORDYLRUDFVQS-UHFFFAOYSA-N |
| XLogP | -5.24 |
| TPSA | 160.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.95 |
| LogP ≤ 5 | -5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze bis(dioxido(dioxo)manganese);platinum(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(dioxido(dioxo)manganese);platinum(4+)?
The IUPAC name of bis(dioxido(dioxo)manganese);platinum(4+) (CID 173135552) is bis(dioxido(dioxo)manganese);platinum(4+).
What is the SMILES notation for bis(dioxido(dioxo)manganese);platinum(4+)?
The canonical SMILES for bis(dioxido(dioxo)manganese);platinum(4+) is O=[Mn](=O)([O-])[O-].O=[Mn](=O)([O-])[O-].[Pt+4].
What is the InChIKey of bis(dioxido(dioxo)manganese);platinum(4+)?
The InChIKey is GWORDYLRUDFVQS-UHFFFAOYSA-N. The full InChI is InChI=1S/2Mn.8O.Pt/q;;;;;;4*-1;+4.
What are the key properties of bis(dioxido(dioxo)manganese);platinum(4+)?
bis(dioxido(dioxo)manganese);platinum(4+) has a molecular weight of 432.95 g/mol, XLogP of -5.24, 0 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(dioxido(dioxo)manganese);platinum(4+) is sourced from PubChem (CID 173135552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).