C20H30ClN3O3S — CID 173136543
1-[[1-(4-chlorophenyl)sulfonylpyrrolidin-3-yl]methyl]-3-cyclooctylurea (PubChem CID 173136543) has the molecular formula C20H30ClN3O3S and a molecular weight of 428.00 g/mol. Its IUPAC name is 1-[[1-(4-chlorophenyl)sulfonylpyrrolidin-3-yl]methyl]-3-cyclooctylurea.
| Compound Name | 1-[[1-(4-chlorophenyl)sulfonylpyrrolidin-3-yl]methyl]-3-cyclooctylurea |
|---|---|
| PubChem CID | 173136543 |
| Molecular Formula | C20H30ClN3O3S |
| Molecular Weight | 428.00 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 1-[[1-(4-chlorophenyl)sulfonylpyrrolidin-3-yl]methyl]-3-cyclooctylurea |
| SMILES | O=C(NCC1CCN(S(=O)(=O)c2ccc(Cl)cc2)C1)NC1CCCCCCC1 |
| InChI | InChI=1S/C20H30ClN3O3S/c21-17-8-10-19(11-9-17)28(26,27)24-13-12-16(15-24)14-22-20(25)23-18-6-4-2-1-3-5-7-18/h8-11,16,18H,1-7,12-15H2,(H2,22,23,25) |
| InChIKey | RODCFDHTKICPDU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.00 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |