About adamantane;cycloheptane
adamantane;cycloheptane (PubChem CID 173136693) has the molecular formula C17H30
and a molecular weight of 234.43 g/mol. Its IUPAC name is adamantane;cycloheptane.
Molecular Properties
| Compound Name | adamantane;cycloheptane |
| PubChem CID | 173136693 |
| Molecular Formula | C17H30 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | adamantane;cycloheptane |
| SMILES | C1C2CC3CC1CC(C2)C3.C1CCCCCC1 |
| InChI | InChI=1S/C10H16.C7H14/c1-7-2-9-4-8(1)5-10(3-7)6-9;1-2-4-6-7-5-3-1/h7-10H,1-6H2;1-7H2 |
| InChIKey | NLPJVEJLGSROHY-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze adamantane;cycloheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane;cycloheptane?
The IUPAC name of adamantane;cycloheptane (CID 173136693) is adamantane;cycloheptane.
What is the SMILES notation for adamantane;cycloheptane?
The canonical SMILES for adamantane;cycloheptane is C1C2CC3CC1CC(C2)C3.C1CCCCCC1.
What is the InChIKey of adamantane;cycloheptane?
The InChIKey is NLPJVEJLGSROHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.C7H14/c1-7-2-9-4-8(1)5-10(3-7)6-9;1-2-4-6-7-5-3-1/h7-10H,1-6H2;1-7H2.
What are the key properties of adamantane;cycloheptane?
adamantane;cycloheptane has a molecular weight of 234.43 g/mol, XLogP of 5.56, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane;cycloheptane is sourced from PubChem (CID 173136693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).