About N,N-dimethylquinolin-2-amine;ethyl formate
N,N-dimethylquinolin-2-amine;ethyl formate (PubChem CID 173137304) has the molecular formula C14H18N2O2
and a molecular weight of 246.31 g/mol. Its IUPAC name is N,N-dimethylquinolin-2-amine;ethyl formate.
Molecular Properties
| Compound Name | N,N-dimethylquinolin-2-amine;ethyl formate |
| PubChem CID | 173137304 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | N,N-dimethylquinolin-2-amine;ethyl formate |
| SMILES | CCOC=O.CN(C)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C11H12N2.C3H6O2/c1-13(2)11-8-7-9-5-3-4-6-10(9)12-11;1-2-5-3-4/h3-8H,1-2H3;3H,2H2,1H3 |
| InChIKey | TUPQGGVHLXNOCN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylquinolin-2-amine;ethyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylquinolin-2-amine;ethyl formate?
The IUPAC name of N,N-dimethylquinolin-2-amine;ethyl formate (CID 173137304) is N,N-dimethylquinolin-2-amine;ethyl formate.
What is the SMILES notation for N,N-dimethylquinolin-2-amine;ethyl formate?
The canonical SMILES for N,N-dimethylquinolin-2-amine;ethyl formate is CCOC=O.CN(C)c1ccc2ccccc2n1.
What is the InChIKey of N,N-dimethylquinolin-2-amine;ethyl formate?
The InChIKey is TUPQGGVHLXNOCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2.C3H6O2/c1-13(2)11-8-7-9-5-3-4-6-10(9)12-11;1-2-5-3-4/h3-8H,1-2H3;3H,2H2,1H3.
What are the key properties of N,N-dimethylquinolin-2-amine;ethyl formate?
N,N-dimethylquinolin-2-amine;ethyl formate has a molecular weight of 246.31 g/mol, XLogP of 2.48, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylquinolin-2-amine;ethyl formate is sourced from PubChem (CID 173137304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).