C13H20 — CID 173137560
cyclopentene;5,5-dimethylcyclohexa-1,3-diene (PubChem CID 173137560) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is cyclopentene;5,5-dimethylcyclohexa-1,3-diene.
| Compound Name | cyclopentene;5,5-dimethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 173137560 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | cyclopentene;5,5-dimethylcyclohexa-1,3-diene |
| SMILES | C1=CCCC1.CC1(C)C=CC=CC1 |
| InChI | InChI=1S/C8H12.C5H8/c1-8(2)6-4-3-5-7-8;1-2-4-5-3-1/h3-6H,7H2,1-2H3;1-2H,3-5H2 |
| InChIKey | WRILURCLEXIYSK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|