About (4-ethyl-3,6-dihydro-2H-pyridin-1-yl)methanimine
(4-ethyl-3,6-dihydro-2H-pyridin-1-yl)methanimine (PubChem CID 173137642) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is (4-ethyl-3,6-dihydro-2H-pyridin-1-yl)methanimine.
Molecular Properties
| Compound Name | (4-ethyl-3,6-dihydro-2H-pyridin-1-yl)methanimine |
| PubChem CID | 173137642 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (4-ethyl-3,6-dihydro-2H-pyridin-1-yl)methanimine |
| SMILES | [H]/N=C/N1CC=C(CC)CC1 |
| InChI | InChI=1S/C8H14N2/c1-2-8-3-5-10(7-9)6-4-8/h3,7,9H,2,4-6H2,1H3/b9-7+ |
| InChIKey | GQZVZVRILPZCBD-VQHVLOKHSA-N |
| XLogP | 1.64 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4-ethyl-3,6-dihydro-2H-pyridin-1-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethyl-3,6-dihydro-2H-pyridin-1-yl)methanimine?
The IUPAC name of (4-ethyl-3,6-dihydro-2H-pyridin-1-yl)methanimine (CID 173137642) is (4-ethyl-3,6-dihydro-2H-pyridin-1-yl)methanimine.
What is the SMILES notation for (4-ethyl-3,6-dihydro-2H-pyridin-1-yl)methanimine?
The canonical SMILES for (4-ethyl-3,6-dihydro-2H-pyridin-1-yl)methanimine is [H]/N=C/N1CC=C(CC)CC1.
What is the InChIKey of (4-ethyl-3,6-dihydro-2H-pyridin-1-yl)methanimine?
The InChIKey is GQZVZVRILPZCBD-VQHVLOKHSA-N. The full InChI is InChI=1S/C8H14N2/c1-2-8-3-5-10(7-9)6-4-8/h3,7,9H,2,4-6H2,1H3/b9-7+.
What are the key properties of (4-ethyl-3,6-dihydro-2H-pyridin-1-yl)methanimine?
(4-ethyl-3,6-dihydro-2H-pyridin-1-yl)methanimine has a molecular weight of 138.21 g/mol, XLogP of 1.64, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethyl-3,6-dihydro-2H-pyridin-1-yl)methanimine is sourced from PubChem (CID 173137642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).