About 2-[(3,4-dimethylpyrazol-1-yl)methyl]-5-methyl-1,3-oxazole
2-[(3,4-dimethylpyrazol-1-yl)methyl]-5-methyl-1,3-oxazole (PubChem CID 173138031) has the molecular formula C10H13N3O
and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-[(3,4-dimethylpyrazol-1-yl)methyl]-5-methyl-1,3-oxazole.
Molecular Properties
| Compound Name | 2-[(3,4-dimethylpyrazol-1-yl)methyl]-5-methyl-1,3-oxazole |
| PubChem CID | 173138031 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 2-[(3,4-dimethylpyrazol-1-yl)methyl]-5-methyl-1,3-oxazole |
| SMILES | Cc1cnc(Cn2cc(C)c(C)n2)o1 |
| InChI | InChI=1S/C10H13N3O/c1-7-5-13(12-9(7)3)6-10-11-4-8(2)14-10/h4-5H,6H2,1-3H3 |
| InChIKey | YFOMFPQQKOQOOK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(3,4-dimethylpyrazol-1-yl)methyl]-5-methyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,4-dimethylpyrazol-1-yl)methyl]-5-methyl-1,3-oxazole?
The IUPAC name of 2-[(3,4-dimethylpyrazol-1-yl)methyl]-5-methyl-1,3-oxazole (CID 173138031) is 2-[(3,4-dimethylpyrazol-1-yl)methyl]-5-methyl-1,3-oxazole.
What is the SMILES notation for 2-[(3,4-dimethylpyrazol-1-yl)methyl]-5-methyl-1,3-oxazole?
The canonical SMILES for 2-[(3,4-dimethylpyrazol-1-yl)methyl]-5-methyl-1,3-oxazole is Cc1cnc(Cn2cc(C)c(C)n2)o1.
What is the InChIKey of 2-[(3,4-dimethylpyrazol-1-yl)methyl]-5-methyl-1,3-oxazole?
The InChIKey is YFOMFPQQKOQOOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O/c1-7-5-13(12-9(7)3)6-10-11-4-8(2)14-10/h4-5H,6H2,1-3H3.
What are the key properties of 2-[(3,4-dimethylpyrazol-1-yl)methyl]-5-methyl-1,3-oxazole?
2-[(3,4-dimethylpyrazol-1-yl)methyl]-5-methyl-1,3-oxazole has a molecular weight of 191.23 g/mol, XLogP of 1.84, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,4-dimethylpyrazol-1-yl)methyl]-5-methyl-1,3-oxazole is sourced from PubChem (CID 173138031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).