About N,N-dimethylmethanamine;dihydrochloride
N,N-dimethylmethanamine;dihydrochloride (PubChem CID 173138112) has the molecular formula C3H11Cl2N
and a molecular weight of 132.03 g/mol. Its IUPAC name is N,N-dimethylmethanamine;dihydrochloride.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;dihydrochloride |
| PubChem CID | 173138112 |
| Molecular Formula | C3H11Cl2N |
| Molecular Weight | 132.03 g/mol |
| Exact Mass | 131.03 |
| IUPAC Name | N,N-dimethylmethanamine;dihydrochloride |
| SMILES | CN(C)C.Cl.Cl |
| InChI | InChI=1S/C3H9N.2ClH/c1-4(2)3;;/h1-3H3;2*1H |
| InChIKey | MVTBQTUWKKCHOI-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.03 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dimethylmethanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;dihydrochloride?
The IUPAC name of N,N-dimethylmethanamine;dihydrochloride (CID 173138112) is N,N-dimethylmethanamine;dihydrochloride.
What is the SMILES notation for N,N-dimethylmethanamine;dihydrochloride?
The canonical SMILES for N,N-dimethylmethanamine;dihydrochloride is CN(C)C.Cl.Cl.
What is the InChIKey of N,N-dimethylmethanamine;dihydrochloride?
The InChIKey is MVTBQTUWKKCHOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.2ClH/c1-4(2)3;;/h1-3H3;2*1H.
What are the key properties of N,N-dimethylmethanamine;dihydrochloride?
N,N-dimethylmethanamine;dihydrochloride has a molecular weight of 132.03 g/mol, XLogP of 1.02, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;dihydrochloride is sourced from PubChem (CID 173138112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).