About [chloro-bis(2,4,6-trimethylphenyl)methyl]silane
[chloro-bis(2,4,6-trimethylphenyl)methyl]silane (PubChem CID 173138613) has the molecular formula C19H25ClSi
and a molecular weight of 316.95 g/mol. Its IUPAC name is [chloro-bis(2,4,6-trimethylphenyl)methyl]silane.
Molecular Properties
| Compound Name | [chloro-bis(2,4,6-trimethylphenyl)methyl]silane |
| PubChem CID | 173138613 |
| Molecular Formula | C19H25ClSi |
| Molecular Weight | 316.95 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | [chloro-bis(2,4,6-trimethylphenyl)methyl]silane |
| SMILES | Cc1cc(C)c(C([SiH3])(Cl)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C19H25ClSi/c1-11-7-13(3)17(14(4)8-11)19(20,21)18-15(5)9-12(2)10-16(18)6/h7-10H,1-6,21H3 |
| InChIKey | STJZQYTVMUMFRL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.95 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [chloro-bis(2,4,6-trimethylphenyl)methyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [chloro-bis(2,4,6-trimethylphenyl)methyl]silane?
The IUPAC name of [chloro-bis(2,4,6-trimethylphenyl)methyl]silane (CID 173138613) is [chloro-bis(2,4,6-trimethylphenyl)methyl]silane.
What is the SMILES notation for [chloro-bis(2,4,6-trimethylphenyl)methyl]silane?
The canonical SMILES for [chloro-bis(2,4,6-trimethylphenyl)methyl]silane is Cc1cc(C)c(C([SiH3])(Cl)c2c(C)cc(C)cc2C)c(C)c1.
What is the InChIKey of [chloro-bis(2,4,6-trimethylphenyl)methyl]silane?
The InChIKey is STJZQYTVMUMFRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25ClSi/c1-11-7-13(3)17(14(4)8-11)19(20,21)18-15(5)9-12(2)10-16(18)6/h7-10H,1-6,21H3.
What are the key properties of [chloro-bis(2,4,6-trimethylphenyl)methyl]silane?
[chloro-bis(2,4,6-trimethylphenyl)methyl]silane has a molecular weight of 316.95 g/mol, XLogP of 4.34, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [chloro-bis(2,4,6-trimethylphenyl)methyl]silane is sourced from PubChem (CID 173138613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).