About azane;2-(benzenesulfonyl)-2-nitroacetic acid
azane;2-(benzenesulfonyl)-2-nitroacetic acid (PubChem CID 173138811) has the molecular formula C8H10N2O6S
and a molecular weight of 262.24 g/mol. Its IUPAC name is azane;2-(benzenesulfonyl)-2-nitroacetic acid.
Molecular Properties
| Compound Name | azane;2-(benzenesulfonyl)-2-nitroacetic acid |
| PubChem CID | 173138811 |
| Molecular Formula | C8H10N2O6S |
| Molecular Weight | 262.24 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | azane;2-(benzenesulfonyl)-2-nitroacetic acid |
| SMILES | N.O=C(O)C([N+](=O)[O-])S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C8H7NO6S.H3N/c10-8(11)7(9(12)13)16(14,15)6-4-2-1-3-5-6;/h1-5,7H,(H,10,11);1H3 |
| InChIKey | SDLSFPRBEQDNHZ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 149.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.24 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azane;2-(benzenesulfonyl)-2-nitroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-(benzenesulfonyl)-2-nitroacetic acid?
The IUPAC name of azane;2-(benzenesulfonyl)-2-nitroacetic acid (CID 173138811) is azane;2-(benzenesulfonyl)-2-nitroacetic acid.
What is the SMILES notation for azane;2-(benzenesulfonyl)-2-nitroacetic acid?
The canonical SMILES for azane;2-(benzenesulfonyl)-2-nitroacetic acid is N.O=C(O)C([N+](=O)[O-])S(=O)(=O)c1ccccc1.
What is the InChIKey of azane;2-(benzenesulfonyl)-2-nitroacetic acid?
The InChIKey is SDLSFPRBEQDNHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO6S.H3N/c10-8(11)7(9(12)13)16(14,15)6-4-2-1-3-5-6;/h1-5,7H,(H,10,11);1H3.
What are the key properties of azane;2-(benzenesulfonyl)-2-nitroacetic acid?
azane;2-(benzenesulfonyl)-2-nitroacetic acid has a molecular weight of 262.24 g/mol, XLogP of 0.31, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-(benzenesulfonyl)-2-nitroacetic acid is sourced from PubChem (CID 173138811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).