About (2S)-2-(2,5-dioxopyrrolidin-1-yl)-2-sulfanylpropanoic acid;pyridine
(2S)-2-(2,5-dioxopyrrolidin-1-yl)-2-sulfanylpropanoic acid;pyridine (PubChem CID 173139216) has the molecular formula C12H14N2O4S
and a molecular weight of 282.32 g/mol. Its IUPAC name is (2S)-2-(2,5-dioxopyrrolidin-1-yl)-2-sulfanylpropanoic acid;pyridine.
Molecular Properties
| Compound Name | (2S)-2-(2,5-dioxopyrrolidin-1-yl)-2-sulfanylpropanoic acid;pyridine |
| PubChem CID | 173139216 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | (2S)-2-(2,5-dioxopyrrolidin-1-yl)-2-sulfanylpropanoic acid;pyridine |
| SMILES | C[C@](S)(C(=O)O)N1C(=O)CCC1=O.c1ccncc1 |
| InChI | InChI=1S/C7H9NO4S.C5H5N/c1-7(13,6(11)12)8-4(9)2-3-5(8)10;1-2-4-6-5-3-1/h13H,2-3H2,1H3,(H,11,12);1-5H/t7-;/m0./s1 |
| InChIKey | OYIWYJOSBNNBBN-FJXQXJEOSA-N |
| XLogP | 0.95 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-(2,5-dioxopyrrolidin-1-yl)-2-sulfanylpropanoic acid;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(2,5-dioxopyrrolidin-1-yl)-2-sulfanylpropanoic acid;pyridine?
The IUPAC name of (2S)-2-(2,5-dioxopyrrolidin-1-yl)-2-sulfanylpropanoic acid;pyridine (CID 173139216) is (2S)-2-(2,5-dioxopyrrolidin-1-yl)-2-sulfanylpropanoic acid;pyridine.
What is the SMILES notation for (2S)-2-(2,5-dioxopyrrolidin-1-yl)-2-sulfanylpropanoic acid;pyridine?
The canonical SMILES for (2S)-2-(2,5-dioxopyrrolidin-1-yl)-2-sulfanylpropanoic acid;pyridine is C[C@](S)(C(=O)O)N1C(=O)CCC1=O.c1ccncc1.
What is the InChIKey of (2S)-2-(2,5-dioxopyrrolidin-1-yl)-2-sulfanylpropanoic acid;pyridine?
The InChIKey is OYIWYJOSBNNBBN-FJXQXJEOSA-N. The full InChI is InChI=1S/C7H9NO4S.C5H5N/c1-7(13,6(11)12)8-4(9)2-3-5(8)10;1-2-4-6-5-3-1/h13H,2-3H2,1H3,(H,11,12);1-5H/t7-;/m0./s1.
What are the key properties of (2S)-2-(2,5-dioxopyrrolidin-1-yl)-2-sulfanylpropanoic acid;pyridine?
(2S)-2-(2,5-dioxopyrrolidin-1-yl)-2-sulfanylpropanoic acid;pyridine has a molecular weight of 282.32 g/mol, XLogP of 0.95, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(2,5-dioxopyrrolidin-1-yl)-2-sulfanylpropanoic acid;pyridine is sourced from PubChem (CID 173139216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).