About 2,3,6-trimethylbenzoic acid
2,3,6-trimethylbenzoic acid (PubChem CID 17314) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is 2,3,6-trimethylbenzoic acid.
Molecular Properties
| Compound Name | 2,3,6-trimethylbenzoic acid |
| PubChem CID | 17314 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 2,3,6-trimethylbenzoic acid |
| SMILES | Cc1ccc(C)c(C(=O)O)c1C |
| InChI | InChI=1S/C10H12O2/c1-6-4-5-7(2)9(8(6)3)10(11)12/h4-5H,1-3H3,(H,11,12) |
| InChIKey | JRUKSSBDIZXQDX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3,6-trimethylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,6-trimethylbenzoic acid?
The IUPAC name of 2,3,6-trimethylbenzoic acid (CID 17314) is 2,3,6-trimethylbenzoic acid.
What is the SMILES notation for 2,3,6-trimethylbenzoic acid?
The canonical SMILES for 2,3,6-trimethylbenzoic acid is Cc1ccc(C)c(C(=O)O)c1C.
What is the InChIKey of 2,3,6-trimethylbenzoic acid?
The InChIKey is JRUKSSBDIZXQDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c1-6-4-5-7(2)9(8(6)3)10(11)12/h4-5H,1-3H3,(H,11,12).
What are the key properties of 2,3,6-trimethylbenzoic acid?
2,3,6-trimethylbenzoic acid has a molecular weight of 164.20 g/mol, XLogP of 2.31, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,6-trimethylbenzoic acid is sourced from PubChem (CID 17314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).