About sodium;hydride;propan-2-yl 2-cyano-4,4,4-trifluoro-3-hydroxybut-2-enoate
sodium;hydride;propan-2-yl 2-cyano-4,4,4-trifluoro-3-hydroxybut-2-enoate (PubChem CID 173140282) has the molecular formula C8H9F3NNaO3
and a molecular weight of 247.15 g/mol. Its IUPAC name is sodium;hydride;propan-2-yl 2-cyano-4,4,4-trifluoro-3-hydroxybut-2-enoate.
Molecular Properties
| Compound Name | sodium;hydride;propan-2-yl 2-cyano-4,4,4-trifluoro-3-hydroxybut-2-enoate |
| PubChem CID | 173140282 |
| Molecular Formula | C8H9F3NNaO3 |
| Molecular Weight | 247.15 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | sodium;hydride;propan-2-yl 2-cyano-4,4,4-trifluoro-3-hydroxybut-2-enoate |
| SMILES | CC(C)OC(=O)C(C#N)=C(O)C(F)(F)F.[H-].[Na+] |
| InChI | InChI=1S/C8H8F3NO3.Na.H/c1-4(2)15-7(14)5(3-12)6(13)8(9,10)11;;/h4,13H,1-2H3;;/q;+1;-1 |
| InChIKey | MUSCOAYJTAIDLS-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.15 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;propan-2-yl 2-cyano-4,4,4-trifluoro-3-hydroxybut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;propan-2-yl 2-cyano-4,4,4-trifluoro-3-hydroxybut-2-enoate?
The IUPAC name of sodium;hydride;propan-2-yl 2-cyano-4,4,4-trifluoro-3-hydroxybut-2-enoate (CID 173140282) is sodium;hydride;propan-2-yl 2-cyano-4,4,4-trifluoro-3-hydroxybut-2-enoate.
What is the SMILES notation for sodium;hydride;propan-2-yl 2-cyano-4,4,4-trifluoro-3-hydroxybut-2-enoate?
The canonical SMILES for sodium;hydride;propan-2-yl 2-cyano-4,4,4-trifluoro-3-hydroxybut-2-enoate is CC(C)OC(=O)C(C#N)=C(O)C(F)(F)F.[H-].[Na+].
What is the InChIKey of sodium;hydride;propan-2-yl 2-cyano-4,4,4-trifluoro-3-hydroxybut-2-enoate?
The InChIKey is MUSCOAYJTAIDLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F3NO3.Na.H/c1-4(2)15-7(14)5(3-12)6(13)8(9,10)11;;/h4,13H,1-2H3;;/q;+1;-1.
What are the key properties of sodium;hydride;propan-2-yl 2-cyano-4,4,4-trifluoro-3-hydroxybut-2-enoate?
sodium;hydride;propan-2-yl 2-cyano-4,4,4-trifluoro-3-hydroxybut-2-enoate has a molecular weight of 247.15 g/mol, XLogP of -1.05, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;propan-2-yl 2-cyano-4,4,4-trifluoro-3-hydroxybut-2-enoate is sourced from PubChem (CID 173140282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).