C22H34 — CID 173140457
1,2,3,6,7,8-hexaethyl-1,4-dihydronaphthalene (PubChem CID 173140457) has the molecular formula C22H34 and a molecular weight of 298.51 g/mol. Its IUPAC name is 1,2,3,6,7,8-hexaethyl-1,4-dihydronaphthalene.
| Compound Name | 1,2,3,6,7,8-hexaethyl-1,4-dihydronaphthalene |
|---|---|
| PubChem CID | 173140457 |
| Molecular Formula | C22H34 |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | 1,2,3,6,7,8-hexaethyl-1,4-dihydronaphthalene |
| SMILES | CCC1=C(CC)C(CC)c2c(cc(CC)c(CC)c2CC)C1 |
| InChI | InChI=1S/C22H34/c1-7-15-13-17-14-16(8-2)19(10-4)21(12-6)22(17)20(11-5)18(15)9-3/h13,21H,7-12,14H2,1-6H3 |
| InChIKey | FLVSNRJBFRDQFF-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|