1-ethenyl-3-ethyl-2H-imidazole;ethyl hydrogen sulfate

C9H18N2O4S — CID 173141341

IUPAC1-ethenyl-3-ethyl-2H-imidazole;ethyl hydrogen sulfate
SMILESC=CN1C=CN(CC)C1.CCOS(=O)(=O)O
InChIInChI=1S/C7H12N2.C2H6O4S/c1-3-8-5-6-9(4-2)7-8;1-2-6-7(3,4)5/h3,5-6H,1,4,7H2,2H3;2H2,1H3,(H,3,4,5)
InChIKeyCDWDFLFDWJBCAI-UHFFFAOYSA-N
MW250.32 g/mol
LogP1.02
Rot. Bonds4

About 1-ethenyl-3-ethyl-2H-imidazole;ethyl hydrogen sulfate

1-ethenyl-3-ethyl-2H-imidazole;ethyl hydrogen sulfate (PubChem CID 173141341) has the molecular formula C9H18N2O4S and a molecular weight of 250.32 g/mol. Its IUPAC name is 1-ethenyl-3-ethyl-2H-imidazole;ethyl hydrogen sulfate.

Molecular Properties

Compound Name1-ethenyl-3-ethyl-2H-imidazole;ethyl hydrogen sulfate
PubChem CID173141341
Molecular FormulaC9H18N2O4S
Molecular Weight250.32 g/mol
Exact Mass250.10
IUPAC Name1-ethenyl-3-ethyl-2H-imidazole;ethyl hydrogen sulfate
SMILESC=CN1C=CN(CC)C1.CCOS(=O)(=O)O
InChIInChI=1S/C7H12N2.C2H6O4S/c1-3-8-5-6-9(4-2)7-8;1-2-6-7(3,4)5/h3,5-6H,1,4,7H2,2H3;2H2,1H3,(H,3,4,5)
InChIKeyCDWDFLFDWJBCAI-UHFFFAOYSA-N
XLogP1.02
TPSA70.08 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.32
LogP ≤ 51.02
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 1-ethenyl-3-ethyl-2H-imidazole;ethyl hydrogen sulfate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-ethenyl-3-ethyl-2H-imidazole;ethyl hydrogen sulfate?
The IUPAC name of 1-ethenyl-3-ethyl-2H-imidazole;ethyl hydrogen sulfate (CID 173141341) is 1-ethenyl-3-ethyl-2H-imidazole;ethyl hydrogen sulfate.
What is the SMILES notation for 1-ethenyl-3-ethyl-2H-imidazole;ethyl hydrogen sulfate?
The canonical SMILES for 1-ethenyl-3-ethyl-2H-imidazole;ethyl hydrogen sulfate is C=CN1C=CN(CC)C1.CCOS(=O)(=O)O.
What is the InChIKey of 1-ethenyl-3-ethyl-2H-imidazole;ethyl hydrogen sulfate?
The InChIKey is CDWDFLFDWJBCAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2.C2H6O4S/c1-3-8-5-6-9(4-2)7-8;1-2-6-7(3,4)5/h3,5-6H,1,4,7H2,2H3;2H2,1H3,(H,3,4,5).
What are the key properties of 1-ethenyl-3-ethyl-2H-imidazole;ethyl hydrogen sulfate?
1-ethenyl-3-ethyl-2H-imidazole;ethyl hydrogen sulfate has a molecular weight of 250.32 g/mol, XLogP of 1.02, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-3-ethyl-2H-imidazole;ethyl hydrogen sulfate is sourced from PubChem (CID 173141341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).