About 2-chloro-1,3-dimethylimidazolidine;hydrobromide
2-chloro-1,3-dimethylimidazolidine;hydrobromide (PubChem CID 173141555) has the molecular formula C5H12BrClN2
and a molecular weight of 215.52 g/mol. Its IUPAC name is 2-chloro-1,3-dimethylimidazolidine;hydrobromide.
Molecular Properties
| Compound Name | 2-chloro-1,3-dimethylimidazolidine;hydrobromide |
| PubChem CID | 173141555 |
| Molecular Formula | C5H12BrClN2 |
| Molecular Weight | 215.52 g/mol |
| Exact Mass | 213.99 |
| IUPAC Name | 2-chloro-1,3-dimethylimidazolidine;hydrobromide |
| SMILES | Br.CN1CCN(C)C1Cl |
| InChI | InChI=1S/C5H11ClN2.BrH/c1-7-3-4-8(2)5(7)6;/h5H,3-4H2,1-2H3;1H |
| InChIKey | WZHXGDFWUWSGOB-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.52 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1,3-dimethylimidazolidine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1,3-dimethylimidazolidine;hydrobromide?
The IUPAC name of 2-chloro-1,3-dimethylimidazolidine;hydrobromide (CID 173141555) is 2-chloro-1,3-dimethylimidazolidine;hydrobromide.
What is the SMILES notation for 2-chloro-1,3-dimethylimidazolidine;hydrobromide?
The canonical SMILES for 2-chloro-1,3-dimethylimidazolidine;hydrobromide is Br.CN1CCN(C)C1Cl.
What is the InChIKey of 2-chloro-1,3-dimethylimidazolidine;hydrobromide?
The InChIKey is WZHXGDFWUWSGOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11ClN2.BrH/c1-7-3-4-8(2)5(7)6;/h5H,3-4H2,1-2H3;1H.
What are the key properties of 2-chloro-1,3-dimethylimidazolidine;hydrobromide?
2-chloro-1,3-dimethylimidazolidine;hydrobromide has a molecular weight of 215.52 g/mol, XLogP of 0.96, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1,3-dimethylimidazolidine;hydrobromide is sourced from PubChem (CID 173141555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).