About 5-methyl-1H-indeno[2,1-b]indole
5-methyl-1H-indeno[2,1-b]indole (PubChem CID 173141591) has the molecular formula C16H13N
and a molecular weight of 219.29 g/mol. Its IUPAC name is 5-methyl-1H-indeno[2,1-b]indole.
Molecular Properties
| Compound Name | 5-methyl-1H-indeno[2,1-b]indole |
| PubChem CID | 173141591 |
| Molecular Formula | C16H13N |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 5-methyl-1H-indeno[2,1-b]indole |
| SMILES | Cn1c2c(c3c1=Cc1ccccc1-3)CC=CC=2 |
| InChI | InChI=1S/C16H13N/c1-17-14-9-5-4-8-13(14)16-12-7-3-2-6-11(12)10-15(16)17/h2-7,9-10H,8H2,1H3 |
| InChIKey | UXBDYUBXZUQMQI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-methyl-1H-indeno[2,1-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1H-indeno[2,1-b]indole?
The IUPAC name of 5-methyl-1H-indeno[2,1-b]indole (CID 173141591) is 5-methyl-1H-indeno[2,1-b]indole.
What is the SMILES notation for 5-methyl-1H-indeno[2,1-b]indole?
The canonical SMILES for 5-methyl-1H-indeno[2,1-b]indole is Cn1c2c(c3c1=Cc1ccccc1-3)CC=CC=2.
What is the InChIKey of 5-methyl-1H-indeno[2,1-b]indole?
The InChIKey is UXBDYUBXZUQMQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N/c1-17-14-9-5-4-8-13(14)16-12-7-3-2-6-11(12)10-15(16)17/h2-7,9-10H,8H2,1H3.
What are the key properties of 5-methyl-1H-indeno[2,1-b]indole?
5-methyl-1H-indeno[2,1-b]indole has a molecular weight of 219.29 g/mol, XLogP of 1.73, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1H-indeno[2,1-b]indole is sourced from PubChem (CID 173141591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).