About 5-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;cyclopentane;ruthenium
5-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;cyclopentane;ruthenium (PubChem CID 173141727) has the molecular formula C15H14Ru-6
and a molecular weight of 295.35 g/mol. Its IUPAC name is 5-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;cyclopentane;ruthenium.
Molecular Properties
| Compound Name | 5-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;cyclopentane;ruthenium |
| PubChem CID | 173141727 |
| Molecular Formula | C15H14Ru-6 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 5-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;cyclopentane;ruthenium |
| SMILES | C1=CCC([c-]2cccc2)=C1.[Ru].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C10H9.C5H5.Ru/c1-2-6-9(5-1)10-7-3-4-8-10;1-2-4-5-3-1;/h1-7H,8H2;1-5H;/q-1;-5; |
| InChIKey | DFIPVXFAVHABKL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;cyclopentane;ruthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;cyclopentane;ruthenium?
The IUPAC name of 5-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;cyclopentane;ruthenium (CID 173141727) is 5-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;cyclopentane;ruthenium.
What is the SMILES notation for 5-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;cyclopentane;ruthenium?
The canonical SMILES for 5-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;cyclopentane;ruthenium is C1=CCC([c-]2cccc2)=C1.[Ru].[cH-]1[cH-][cH-][cH-][cH-]1.
What is the InChIKey of 5-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;cyclopentane;ruthenium?
The InChIKey is DFIPVXFAVHABKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9.C5H5.Ru/c1-2-6-9(5-1)10-7-3-4-8-10;1-2-4-5-3-1;/h1-7H,8H2;1-5H;/q-1;-5;.
What are the key properties of 5-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;cyclopentane;ruthenium?
5-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;cyclopentane;ruthenium has a molecular weight of 295.35 g/mol, XLogP of 4.15, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;cyclopentane;ruthenium is sourced from PubChem (CID 173141727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).