3-hydroxyhept-3-enoic acid

C7H12O3 — CID 173143432

IUPAC3-hydroxyhept-3-enoic acid
SMILESCCCC=C(O)CC(=O)O
InChIInChI=1S/C7H12O3/c1-2-3-4-6(8)5-7(9)10/h4,8H,2-3,5H2,1H3,(H,9,10)
InChIKeyJYLFUAWWORNEDO-UHFFFAOYSA-N
MW144.17 g/mol
LogP1.70
Rot. Bonds4

About 3-hydroxyhept-3-enoic acid

3-hydroxyhept-3-enoic acid (PubChem CID 173143432) has the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. Its IUPAC name is 3-hydroxyhept-3-enoic acid.

Molecular Properties

Compound Name3-hydroxyhept-3-enoic acid
PubChem CID173143432
Molecular FormulaC7H12O3
Molecular Weight144.17 g/mol
Exact Mass144.08
IUPAC Name3-hydroxyhept-3-enoic acid
SMILESCCCC=C(O)CC(=O)O
InChIInChI=1S/C7H12O3/c1-2-3-4-6(8)5-7(9)10/h4,8H,2-3,5H2,1H3,(H,9,10)
InChIKeyJYLFUAWWORNEDO-UHFFFAOYSA-N
XLogP1.70
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500144.17
LogP ≤ 51.70
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}

Analyze 3-hydroxyhept-3-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-hydroxyhept-3-enoic acid?
The IUPAC name of 3-hydroxyhept-3-enoic acid (CID 173143432) is 3-hydroxyhept-3-enoic acid.
What is the SMILES notation for 3-hydroxyhept-3-enoic acid?
The canonical SMILES for 3-hydroxyhept-3-enoic acid is CCCC=C(O)CC(=O)O.
What is the InChIKey of 3-hydroxyhept-3-enoic acid?
The InChIKey is JYLFUAWWORNEDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3/c1-2-3-4-6(8)5-7(9)10/h4,8H,2-3,5H2,1H3,(H,9,10).
What are the key properties of 3-hydroxyhept-3-enoic acid?
3-hydroxyhept-3-enoic acid has a molecular weight of 144.17 g/mol, XLogP of 1.70, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxyhept-3-enoic acid is sourced from PubChem (CID 173143432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).