About 8-azatetracyclo[7.5.0.02,7.012,14]tetradecan-11-one
8-azatetracyclo[7.5.0.02,7.012,14]tetradecan-11-one (PubChem CID 173144513) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is 8-azatetracyclo[7.5.0.02,7.012,14]tetradecan-11-one.
Molecular Properties
| Compound Name | 8-azatetracyclo[7.5.0.02,7.012,14]tetradecan-11-one |
| PubChem CID | 173144513 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 8-azatetracyclo[7.5.0.02,7.012,14]tetradecan-11-one |
| SMILES | O=C1CC2NC3CCCCC3C2C2CC12 |
| InChI | InChI=1S/C13H19NO/c15-12-6-11-13(9-5-8(9)12)7-3-1-2-4-10(7)14-11/h7-11,13-14H,1-6H2 |
| InChIKey | SRDUBFSNWVMVMW-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-azatetracyclo[7.5.0.02,7.012,14]tetradecan-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-azatetracyclo[7.5.0.02,7.012,14]tetradecan-11-one?
The IUPAC name of 8-azatetracyclo[7.5.0.02,7.012,14]tetradecan-11-one (CID 173144513) is 8-azatetracyclo[7.5.0.02,7.012,14]tetradecan-11-one.
What is the SMILES notation for 8-azatetracyclo[7.5.0.02,7.012,14]tetradecan-11-one?
The canonical SMILES for 8-azatetracyclo[7.5.0.02,7.012,14]tetradecan-11-one is O=C1CC2NC3CCCCC3C2C2CC12.
What is the InChIKey of 8-azatetracyclo[7.5.0.02,7.012,14]tetradecan-11-one?
The InChIKey is SRDUBFSNWVMVMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO/c15-12-6-11-13(9-5-8(9)12)7-3-1-2-4-10(7)14-11/h7-11,13-14H,1-6H2.
What are the key properties of 8-azatetracyclo[7.5.0.02,7.012,14]tetradecan-11-one?
8-azatetracyclo[7.5.0.02,7.012,14]tetradecan-11-one has a molecular weight of 205.30 g/mol, XLogP of 1.74, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-azatetracyclo[7.5.0.02,7.012,14]tetradecan-11-one is sourced from PubChem (CID 173144513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).