About 5-methylnonan-5-yloxy(3,3,3-trifluoropropyl)silane
5-methylnonan-5-yloxy(3,3,3-trifluoropropyl)silane (PubChem CID 173144667) has the molecular formula C13H27F3OSi
and a molecular weight of 284.44 g/mol. Its IUPAC name is 5-methylnonan-5-yloxy(3,3,3-trifluoropropyl)silane.
Molecular Properties
| Compound Name | 5-methylnonan-5-yloxy(3,3,3-trifluoropropyl)silane |
| PubChem CID | 173144667 |
| Molecular Formula | C13H27F3OSi |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 5-methylnonan-5-yloxy(3,3,3-trifluoropropyl)silane |
| SMILES | CCCCC(C)(CCCC)O[SiH2]CCC(F)(F)F |
| InChI | InChI=1S/C13H27F3OSi/c1-4-6-8-12(3,9-7-5-2)17-18-11-10-13(14,15)16/h4-11,18H2,1-3H3 |
| InChIKey | RRYCCKMCTFWDIB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-methylnonan-5-yloxy(3,3,3-trifluoropropyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylnonan-5-yloxy(3,3,3-trifluoropropyl)silane?
The IUPAC name of 5-methylnonan-5-yloxy(3,3,3-trifluoropropyl)silane (CID 173144667) is 5-methylnonan-5-yloxy(3,3,3-trifluoropropyl)silane.
What is the SMILES notation for 5-methylnonan-5-yloxy(3,3,3-trifluoropropyl)silane?
The canonical SMILES for 5-methylnonan-5-yloxy(3,3,3-trifluoropropyl)silane is CCCCC(C)(CCCC)O[SiH2]CCC(F)(F)F.
What is the InChIKey of 5-methylnonan-5-yloxy(3,3,3-trifluoropropyl)silane?
The InChIKey is RRYCCKMCTFWDIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27F3OSi/c1-4-6-8-12(3,9-7-5-2)17-18-11-10-13(14,15)16/h4-11,18H2,1-3H3.
What are the key properties of 5-methylnonan-5-yloxy(3,3,3-trifluoropropyl)silane?
5-methylnonan-5-yloxy(3,3,3-trifluoropropyl)silane has a molecular weight of 284.44 g/mol, XLogP of 4.60, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylnonan-5-yloxy(3,3,3-trifluoropropyl)silane is sourced from PubChem (CID 173144667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).