C21H26F3N3O7S — CID 173145108
[(2R)-1-amino-3-carboxypropan-2-yl]-dimethyl-[methyl-(3-phenoxyphenyl)sulfamoyl]azanium;2,2,2-trifluoroacetate (PubChem CID 173145108) has the molecular formula C21H26F3N3O7S and a molecular weight of 521.51 g/mol. Its IUPAC name is [(2R)-1-amino-3-carboxypropan-2-yl]-dimethyl-[methyl-(3-phenoxyphenyl)sulfamoyl]azanium;2,2,2-trifluoroacetate.
| Compound Name | [(2R)-1-amino-3-carboxypropan-2-yl]-dimethyl-[methyl-(3-phenoxyphenyl)sulfamoyl]azanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 173145108 |
| Molecular Formula | C21H26F3N3O7S |
| Molecular Weight | 521.51 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | [(2R)-1-amino-3-carboxypropan-2-yl]-dimethyl-[methyl-(3-phenoxyphenyl)sulfamoyl]azanium;2,2,2-trifluoroacetate |
| SMILES | CN(c1cccc(Oc2ccccc2)c1)S(=O)(=O)[N+](C)(C)[C@@H](CN)CC(=O)O.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C19H25N3O5S.C2HF3O2/c1-21(28(25,26)22(2,3)16(14-20)13-19(23)24)15-8-7-11-18(12-15)27-17-9-5-4-6-10-17;3-2(4,5)1(6)7/h4-12,16H,13-14,20H2,1-3H3;(H,6,7)/t16-;/m1./s1 |
| InChIKey | VHZZBAANXYWALI-PKLMIRHRSA-N |
| XLogP | 1.34 |
| TPSA | 150.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.51 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|