C31H23N5O2S — CID 17314524
N-[(2-naphthalen-1-ylbenzotriazol-5-yl)carbamothioyl]-3-phenylmethoxybenzamide (PubChem CID 17314524) has the molecular formula C31H23N5O2S and a molecular weight of 529.63 g/mol. Its IUPAC name is N-[(2-naphthalen-1-ylbenzotriazol-5-yl)carbamothioyl]-3-phenylmethoxybenzamide.
| Compound Name | N-[(2-naphthalen-1-ylbenzotriazol-5-yl)carbamothioyl]-3-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 17314524 |
| Molecular Formula | C31H23N5O2S |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | N-[(2-naphthalen-1-ylbenzotriazol-5-yl)carbamothioyl]-3-phenylmethoxybenzamide |
| SMILES | O=C(NC(=S)Nc1ccc2nn(-c3cccc4ccccc34)nc2c1)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C31H23N5O2S/c37-30(23-12-6-13-25(18-23)38-20-21-8-2-1-3-9-21)33-31(39)32-24-16-17-27-28(19-24)35-36(34-27)29-15-7-11-22-10-4-5-14-26(22)29/h1-19H,20H2,(H2,32,33,37,39) |
| InChIKey | QQAXYZBITBFMLC-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|