About azane;hydroxy nitrate
azane;hydroxy nitrate (PubChem CID 173145569) has the molecular formula H4N2O4
and a molecular weight of 96.04 g/mol. Its IUPAC name is azane;hydroxy nitrate.
Molecular Properties
| Compound Name | azane;hydroxy nitrate |
| PubChem CID | 173145569 |
| Molecular Formula | H4N2O4 |
| Molecular Weight | 96.04 g/mol |
| Exact Mass | 96.02 |
| IUPAC Name | azane;hydroxy nitrate |
| SMILES | N.O=[N+]([O-])OO |
| InChI | InChI=1S/HNO4.H3N/c2-1(3)5-4;/h4H;1H3 |
| InChIKey | BUDNEDOAZARAJC-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 107.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 96.04 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze azane;hydroxy nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;hydroxy nitrate?
The IUPAC name of azane;hydroxy nitrate (CID 173145569) is azane;hydroxy nitrate.
What is the SMILES notation for azane;hydroxy nitrate?
The canonical SMILES for azane;hydroxy nitrate is N.O=[N+]([O-])OO.
What is the InChIKey of azane;hydroxy nitrate?
The InChIKey is BUDNEDOAZARAJC-UHFFFAOYSA-N. The full InChI is InChI=1S/HNO4.H3N/c2-1(3)5-4;/h4H;1H3.
What are the key properties of azane;hydroxy nitrate?
azane;hydroxy nitrate has a molecular weight of 96.04 g/mol, XLogP of -0.17, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;hydroxy nitrate is sourced from PubChem (CID 173145569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).