C8H24OSi4 — CID 173147301
1,3-disilolane;1-ethoxy-1,3-disilolane (PubChem CID 173147301) has the molecular formula C8H24OSi4 and a molecular weight of 248.62 g/mol. Its IUPAC name is 1,3-disilolane;1-ethoxy-1,3-disilolane.
| Compound Name | 1,3-disilolane;1-ethoxy-1,3-disilolane |
|---|---|
| PubChem CID | 173147301 |
| Molecular Formula | C8H24OSi4 |
| Molecular Weight | 248.62 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 1,3-disilolane;1-ethoxy-1,3-disilolane |
| SMILES | C1C[SiH2]C[SiH2]1.CCO[SiH]1CC[SiH2]C1 |
| InChI | InChI=1S/C5H14OSi2.C3H10Si2/c1-2-6-8-4-3-7-5-8;1-2-5-3-4-1/h8H,2-5,7H2,1H3;1-5H2 |
| InChIKey | GOLDIYLTYSRVGW-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.62 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|