C24H29AsN3NaO7S — CID 173147899
sodium;2-[[5-(4-dimethylarsanylsulfonylphenyl)-8-methyl-2-oxo-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinolin-3-ylidene]amino]oxy-4-hydroxybutanoic acid;hydride (PubChem CID 173147899) has the molecular formula C24H29AsN3NaO7S and a molecular weight of 601.49 g/mol. Its IUPAC name is sodium;2-[[5-(4-dimethylarsanylsulfonylphenyl)-8-methyl-2-oxo-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinolin-3-ylidene]amino]oxy-4-hydroxybutanoic acid;hydride.
| Compound Name | sodium;2-[[5-(4-dimethylarsanylsulfonylphenyl)-8-methyl-2-oxo-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinolin-3-ylidene]amino]oxy-4-hydroxybutanoic acid;hydride |
|---|---|
| PubChem CID | 173147899 |
| Molecular Formula | C24H29AsN3NaO7S |
| Molecular Weight | 601.49 g/mol |
| Exact Mass | 601.08 |
| IUPAC Name | sodium;2-[[5-(4-dimethylarsanylsulfonylphenyl)-8-methyl-2-oxo-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinolin-3-ylidene]amino]oxy-4-hydroxybutanoic acid;hydride |
| SMILES | CN1CCc2c(-c3ccc(S(=O)(=O)[As](C)C)cc3)cc3c(c2C1)NC(=O)C3=NOC(CCO)C(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C24H28AsN3O7S.Na.H/c1-25(2)36(33,34)15-6-4-14(5-7-15)17-12-18-21(19-13-28(3)10-8-16(17)19)26-23(30)22(18)27-35-20(9-11-29)24(31)32;;/h4-7,12,20,29H,8-11,13H2,1-3H3,(H,31,32)(H,26,27,30);;/q;+1;-1 |
| InChIKey | XNKIGZYCSVLLSH-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 145.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.49 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|