About 2-(2-ethoxycyclohexa-1,5-dien-1-yl)pyrimidine
2-(2-ethoxycyclohexa-1,5-dien-1-yl)pyrimidine (PubChem CID 173147914) has the molecular formula C12H14N2O
and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-(2-ethoxycyclohexa-1,5-dien-1-yl)pyrimidine.
Molecular Properties
| Compound Name | 2-(2-ethoxycyclohexa-1,5-dien-1-yl)pyrimidine |
| PubChem CID | 173147914 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 2-(2-ethoxycyclohexa-1,5-dien-1-yl)pyrimidine |
| SMILES | CCOC1=C(c2ncccn2)C=CCC1 |
| InChI | InChI=1S/C12H14N2O/c1-2-15-11-7-4-3-6-10(11)12-13-8-5-9-14-12/h3,5-6,8-9H,2,4,7H2,1H3 |
| InChIKey | JKNGIGCBDXOYBI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-ethoxycyclohexa-1,5-dien-1-yl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethoxycyclohexa-1,5-dien-1-yl)pyrimidine?
The IUPAC name of 2-(2-ethoxycyclohexa-1,5-dien-1-yl)pyrimidine (CID 173147914) is 2-(2-ethoxycyclohexa-1,5-dien-1-yl)pyrimidine.
What is the SMILES notation for 2-(2-ethoxycyclohexa-1,5-dien-1-yl)pyrimidine?
The canonical SMILES for 2-(2-ethoxycyclohexa-1,5-dien-1-yl)pyrimidine is CCOC1=C(c2ncccn2)C=CCC1.
What is the InChIKey of 2-(2-ethoxycyclohexa-1,5-dien-1-yl)pyrimidine?
The InChIKey is JKNGIGCBDXOYBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O/c1-2-15-11-7-4-3-6-10(11)12-13-8-5-9-14-12/h3,5-6,8-9H,2,4,7H2,1H3.
What are the key properties of 2-(2-ethoxycyclohexa-1,5-dien-1-yl)pyrimidine?
2-(2-ethoxycyclohexa-1,5-dien-1-yl)pyrimidine has a molecular weight of 202.26 g/mol, XLogP of 2.57, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethoxycyclohexa-1,5-dien-1-yl)pyrimidine is sourced from PubChem (CID 173147914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).