About N,N-diethyl-N'-[6-(2-methoxyphenyl)pyrimidin-4-yl]-N'-(4-methylphenyl)ethane-1,2-diamine
N,N-diethyl-N'-[6-(2-methoxyphenyl)pyrimidin-4-yl]-N'-(4-methylphenyl)ethane-1,2-diamine (PubChem CID 173148075) has the molecular formula C24H30N4O
and a molecular weight of 390.53 g/mol. Its IUPAC name is N,N-diethyl-N'-[6-(2-methoxyphenyl)pyrimidin-4-yl]-N'-(4-methylphenyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N,N-diethyl-N'-[6-(2-methoxyphenyl)pyrimidin-4-yl]-N'-(4-methylphenyl)ethane-1,2-diamine |
| PubChem CID | 173148075 |
| Molecular Formula | C24H30N4O |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | N,N-diethyl-N'-[6-(2-methoxyphenyl)pyrimidin-4-yl]-N'-(4-methylphenyl)ethane-1,2-diamine |
| SMILES | CCN(CC)CCN(c1ccc(C)cc1)c1cc(-c2ccccc2OC)ncn1 |
| InChI | InChI=1S/C24H30N4O/c1-5-27(6-2)15-16-28(20-13-11-19(3)12-14-20)24-17-22(25-18-26-24)21-9-7-8-10-23(21)29-4/h7-14,17-18H,5-6,15-16H2,1-4H3 |
| InChIKey | HWRMDPLWUNTYTB-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,N-diethyl-N'-[6-(2-methoxyphenyl)pyrimidin-4-yl]-N'-(4-methylphenyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-N'-[6-(2-methoxyphenyl)pyrimidin-4-yl]-N'-(4-methylphenyl)ethane-1,2-diamine?
The IUPAC name of N,N-diethyl-N'-[6-(2-methoxyphenyl)pyrimidin-4-yl]-N'-(4-methylphenyl)ethane-1,2-diamine (CID 173148075) is N,N-diethyl-N'-[6-(2-methoxyphenyl)pyrimidin-4-yl]-N'-(4-methylphenyl)ethane-1,2-diamine.
What is the SMILES notation for N,N-diethyl-N'-[6-(2-methoxyphenyl)pyrimidin-4-yl]-N'-(4-methylphenyl)ethane-1,2-diamine?
The canonical SMILES for N,N-diethyl-N'-[6-(2-methoxyphenyl)pyrimidin-4-yl]-N'-(4-methylphenyl)ethane-1,2-diamine is CCN(CC)CCN(c1ccc(C)cc1)c1cc(-c2ccccc2OC)ncn1.
What is the InChIKey of N,N-diethyl-N'-[6-(2-methoxyphenyl)pyrimidin-4-yl]-N'-(4-methylphenyl)ethane-1,2-diamine?
The InChIKey is HWRMDPLWUNTYTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30N4O/c1-5-27(6-2)15-16-28(20-13-11-19(3)12-14-20)24-17-22(25-18-26-24)21-9-7-8-10-23(21)29-4/h7-14,17-18H,5-6,15-16H2,1-4H3.
What are the key properties of N,N-diethyl-N'-[6-(2-methoxyphenyl)pyrimidin-4-yl]-N'-(4-methylphenyl)ethane-1,2-diamine?
N,N-diethyl-N'-[6-(2-methoxyphenyl)pyrimidin-4-yl]-N'-(4-methylphenyl)ethane-1,2-diamine has a molecular weight of 390.53 g/mol, XLogP of 4.94, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-N'-[6-(2-methoxyphenyl)pyrimidin-4-yl]-N'-(4-methylphenyl)ethane-1,2-diamine is sourced from PubChem (CID 173148075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).