About cobalt;2-cyclopenta-1,3-dien-1-ylcyclohexa-1,3-diene
cobalt;2-cyclopenta-1,3-dien-1-ylcyclohexa-1,3-diene (PubChem CID 173149174) has the molecular formula C11H11Co-
and a molecular weight of 202.14 g/mol. Its IUPAC name is cobalt;2-cyclopenta-1,3-dien-1-ylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | cobalt;2-cyclopenta-1,3-dien-1-ylcyclohexa-1,3-diene |
| PubChem CID | 173149174 |
| Molecular Formula | C11H11Co- |
| Molecular Weight | 202.14 g/mol |
| Exact Mass | 202.02 |
| IUPAC Name | cobalt;2-cyclopenta-1,3-dien-1-ylcyclohexa-1,3-diene |
| SMILES | [C-]1=C(C2=CC=CC2)C=CCC1.[Co] |
| InChI | InChI=1S/C11H11.Co/c1-2-6-10(7-3-1)11-8-4-5-9-11;/h2,4-6,8H,1,3,9H2;/q-1; |
| InChIKey | TYZYCHCEQYTWBB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.14 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cobalt;2-cyclopenta-1,3-dien-1-ylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;2-cyclopenta-1,3-dien-1-ylcyclohexa-1,3-diene?
The IUPAC name of cobalt;2-cyclopenta-1,3-dien-1-ylcyclohexa-1,3-diene (CID 173149174) is cobalt;2-cyclopenta-1,3-dien-1-ylcyclohexa-1,3-diene.
What is the SMILES notation for cobalt;2-cyclopenta-1,3-dien-1-ylcyclohexa-1,3-diene?
The canonical SMILES for cobalt;2-cyclopenta-1,3-dien-1-ylcyclohexa-1,3-diene is [C-]1=C(C2=CC=CC2)C=CCC1.[Co].
What is the InChIKey of cobalt;2-cyclopenta-1,3-dien-1-ylcyclohexa-1,3-diene?
The InChIKey is TYZYCHCEQYTWBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11.Co/c1-2-6-10(7-3-1)11-8-4-5-9-11;/h2,4-6,8H,1,3,9H2;/q-1;.
What are the key properties of cobalt;2-cyclopenta-1,3-dien-1-ylcyclohexa-1,3-diene?
cobalt;2-cyclopenta-1,3-dien-1-ylcyclohexa-1,3-diene has a molecular weight of 202.14 g/mol, XLogP of 2.95, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;2-cyclopenta-1,3-dien-1-ylcyclohexa-1,3-diene is sourced from PubChem (CID 173149174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).