About CID 173149311
CID 173149311 (PubChem CID 173149311) has the molecular formula H4NaO6S4
and a molecular weight of 251.28 g/mol.
Molecular Properties
| Compound Name | CID 173149311 |
| PubChem CID | 173149311 |
| Molecular Formula | H4NaO6S4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 250.88 |
| IUPAC Name | — |
| SMILES | O=S(O)(O)=S.O=S(O)(O)=S.[Na] |
| InChI | InChI=1S/Na.2H2O3S2/c;2*1-5(2,3)4/h;2*(H2,1,2,3,4) |
| InChIKey | BQBNKZRQHNNENC-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 173149311 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173149311?
The IUPAC name of CID 173149311 (CID 173149311) is not available.
What is the SMILES notation for CID 173149311?
The canonical SMILES for CID 173149311 is O=S(O)(O)=S.O=S(O)(O)=S.[Na].
What is the InChIKey of CID 173149311?
The InChIKey is BQBNKZRQHNNENC-UHFFFAOYSA-N. The full InChI is InChI=1S/Na.2H2O3S2/c;2*1-5(2,3)4/h;2*(H2,1,2,3,4).
What are the key properties of CID 173149311?
CID 173149311 has a molecular weight of 251.28 g/mol, XLogP of -1.02, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173149311 is sourced from PubChem (CID 173149311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).