About phosphane;5-sulfooxybenzene-1,3-dicarboxylic acid
phosphane;5-sulfooxybenzene-1,3-dicarboxylic acid (PubChem CID 173149538) has the molecular formula C8H12O8P2S
and a molecular weight of 330.19 g/mol. Its IUPAC name is phosphane;5-sulfooxybenzene-1,3-dicarboxylic acid.
Molecular Properties
| Compound Name | phosphane;5-sulfooxybenzene-1,3-dicarboxylic acid |
| PubChem CID | 173149538 |
| Molecular Formula | C8H12O8P2S |
| Molecular Weight | 330.19 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | phosphane;5-sulfooxybenzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(OS(=O)(=O)O)cc(C(=O)O)c1.P.P |
| InChI | InChI=1S/C8H6O8S.2H3P/c9-7(10)4-1-5(8(11)12)3-6(2-4)16-17(13,14)15;;/h1-3H,(H,9,10)(H,11,12)(H,13,14,15);2*1H3 |
| InChIKey | NLHAGCAOJACNEW-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.19 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze phosphane;5-sulfooxybenzene-1,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phosphane;5-sulfooxybenzene-1,3-dicarboxylic acid?
The IUPAC name of phosphane;5-sulfooxybenzene-1,3-dicarboxylic acid (CID 173149538) is phosphane;5-sulfooxybenzene-1,3-dicarboxylic acid.
What is the SMILES notation for phosphane;5-sulfooxybenzene-1,3-dicarboxylic acid?
The canonical SMILES for phosphane;5-sulfooxybenzene-1,3-dicarboxylic acid is O=C(O)c1cc(OS(=O)(=O)O)cc(C(=O)O)c1.P.P.
What is the InChIKey of phosphane;5-sulfooxybenzene-1,3-dicarboxylic acid?
The InChIKey is NLHAGCAOJACNEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O8S.2H3P/c9-7(10)4-1-5(8(11)12)3-6(2-4)16-17(13,14)15;;/h1-3H,(H,9,10)(H,11,12)(H,13,14,15);2*1H3.
What are the key properties of phosphane;5-sulfooxybenzene-1,3-dicarboxylic acid?
phosphane;5-sulfooxybenzene-1,3-dicarboxylic acid has a molecular weight of 330.19 g/mol, XLogP of 0.38, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phosphane;5-sulfooxybenzene-1,3-dicarboxylic acid is sourced from PubChem (CID 173149538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).