About 4-(5,6-dimethoxy-1H-benzimidazol-2-yl)-1,3-thiazole-2-carboxamide
4-(5,6-dimethoxy-1H-benzimidazol-2-yl)-1,3-thiazole-2-carboxamide (PubChem CID 173150144) has the molecular formula C13H12N4O3S
and a molecular weight of 304.33 g/mol. Its IUPAC name is 4-(5,6-dimethoxy-1H-benzimidazol-2-yl)-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | 4-(5,6-dimethoxy-1H-benzimidazol-2-yl)-1,3-thiazole-2-carboxamide |
| PubChem CID | 173150144 |
| Molecular Formula | C13H12N4O3S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 4-(5,6-dimethoxy-1H-benzimidazol-2-yl)-1,3-thiazole-2-carboxamide |
| SMILES | COc1cc2nc(-c3csc(C(N)=O)n3)[nH]c2cc1OC |
| InChI | InChI=1S/C13H12N4O3S/c1-19-9-3-6-7(4-10(9)20-2)16-12(15-6)8-5-21-13(17-8)11(14)18/h3-5H,1-2H3,(H2,14,18)(H,15,16) |
| InChIKey | XUZZWVBTPMCMBF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(5,6-dimethoxy-1H-benzimidazol-2-yl)-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5,6-dimethoxy-1H-benzimidazol-2-yl)-1,3-thiazole-2-carboxamide?
The IUPAC name of 4-(5,6-dimethoxy-1H-benzimidazol-2-yl)-1,3-thiazole-2-carboxamide (CID 173150144) is 4-(5,6-dimethoxy-1H-benzimidazol-2-yl)-1,3-thiazole-2-carboxamide.
What is the SMILES notation for 4-(5,6-dimethoxy-1H-benzimidazol-2-yl)-1,3-thiazole-2-carboxamide?
The canonical SMILES for 4-(5,6-dimethoxy-1H-benzimidazol-2-yl)-1,3-thiazole-2-carboxamide is COc1cc2nc(-c3csc(C(N)=O)n3)[nH]c2cc1OC.
What is the InChIKey of 4-(5,6-dimethoxy-1H-benzimidazol-2-yl)-1,3-thiazole-2-carboxamide?
The InChIKey is XUZZWVBTPMCMBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4O3S/c1-19-9-3-6-7(4-10(9)20-2)16-12(15-6)8-5-21-13(17-8)11(14)18/h3-5H,1-2H3,(H2,14,18)(H,15,16).
What are the key properties of 4-(5,6-dimethoxy-1H-benzimidazol-2-yl)-1,3-thiazole-2-carboxamide?
4-(5,6-dimethoxy-1H-benzimidazol-2-yl)-1,3-thiazole-2-carboxamide has a molecular weight of 304.33 g/mol, XLogP of 1.80, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5,6-dimethoxy-1H-benzimidazol-2-yl)-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 173150144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).