C30H18O4 — CID 173151279
1,5-diphenylanthracene-2,3,6,7-tetracarbaldehyde (PubChem CID 173151279) has the molecular formula C30H18O4 and a molecular weight of 442.47 g/mol. Its IUPAC name is 1,5-diphenylanthracene-2,3,6,7-tetracarbaldehyde.
| Compound Name | 1,5-diphenylanthracene-2,3,6,7-tetracarbaldehyde |
|---|---|
| PubChem CID | 173151279 |
| Molecular Formula | C30H18O4 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 1,5-diphenylanthracene-2,3,6,7-tetracarbaldehyde |
| SMILES | O=Cc1cc2cc3c(-c4ccccc4)c(C=O)c(C=O)cc3cc2c(-c2ccccc2)c1C=O |
| InChI | InChI=1S/C30H18O4/c31-15-23-11-21-14-26-22(13-25(21)29(27(23)17-33)19-7-3-1-4-8-19)12-24(16-32)28(18-34)30(26)20-9-5-2-6-10-20/h1-18H |
| InChIKey | SZUJCHPPJAMCIV-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|