About 3-pyrrolidin-3-yl-2,5-dihydro-1H-pyrrole
3-pyrrolidin-3-yl-2,5-dihydro-1H-pyrrole (PubChem CID 173151824) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is 3-pyrrolidin-3-yl-2,5-dihydro-1H-pyrrole.
Molecular Properties
| Compound Name | 3-pyrrolidin-3-yl-2,5-dihydro-1H-pyrrole |
| PubChem CID | 173151824 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 3-pyrrolidin-3-yl-2,5-dihydro-1H-pyrrole |
| SMILES | C1=C(C2CCNC2)CNC1 |
| InChI | InChI=1S/C8H14N2/c1-3-9-5-7(1)8-2-4-10-6-8/h1,8-10H,2-6H2 |
| InChIKey | DQNOTEJJPVVBMQ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-pyrrolidin-3-yl-2,5-dihydro-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrrolidin-3-yl-2,5-dihydro-1H-pyrrole?
The IUPAC name of 3-pyrrolidin-3-yl-2,5-dihydro-1H-pyrrole (CID 173151824) is 3-pyrrolidin-3-yl-2,5-dihydro-1H-pyrrole.
What is the SMILES notation for 3-pyrrolidin-3-yl-2,5-dihydro-1H-pyrrole?
The canonical SMILES for 3-pyrrolidin-3-yl-2,5-dihydro-1H-pyrrole is C1=C(C2CCNC2)CNC1.
What is the InChIKey of 3-pyrrolidin-3-yl-2,5-dihydro-1H-pyrrole?
The InChIKey is DQNOTEJJPVVBMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2/c1-3-9-5-7(1)8-2-4-10-6-8/h1,8-10H,2-6H2.
What are the key properties of 3-pyrrolidin-3-yl-2,5-dihydro-1H-pyrrole?
3-pyrrolidin-3-yl-2,5-dihydro-1H-pyrrole has a molecular weight of 138.21 g/mol, XLogP of 0.13, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrrolidin-3-yl-2,5-dihydro-1H-pyrrole is sourced from PubChem (CID 173151824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).