About cyclohexa-1,5-dien-1-yl(piperidin-1-yl)methanimine
cyclohexa-1,5-dien-1-yl(piperidin-1-yl)methanimine (PubChem CID 173151829) has the molecular formula C12H18N2
and a molecular weight of 190.29 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-yl(piperidin-1-yl)methanimine.
Molecular Properties
| Compound Name | cyclohexa-1,5-dien-1-yl(piperidin-1-yl)methanimine |
| PubChem CID | 173151829 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | cyclohexa-1,5-dien-1-yl(piperidin-1-yl)methanimine |
| SMILES | [H]/N=C(\C1=CCCC=C1)N1CCCCC1 |
| InChI | InChI=1S/C12H18N2/c13-12(11-7-3-1-4-8-11)14-9-5-2-6-10-14/h3,7-8,13H,1-2,4-6,9-10H2/b13-12+ |
| InChIKey | MWIOFDBNPXRPDZ-OUKQBFOZSA-N |
| XLogP | 2.73 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze cyclohexa-1,5-dien-1-yl(piperidin-1-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-1,5-dien-1-yl(piperidin-1-yl)methanimine?
The IUPAC name of cyclohexa-1,5-dien-1-yl(piperidin-1-yl)methanimine (CID 173151829) is cyclohexa-1,5-dien-1-yl(piperidin-1-yl)methanimine.
What is the SMILES notation for cyclohexa-1,5-dien-1-yl(piperidin-1-yl)methanimine?
The canonical SMILES for cyclohexa-1,5-dien-1-yl(piperidin-1-yl)methanimine is [H]/N=C(\C1=CCCC=C1)N1CCCCC1.
What is the InChIKey of cyclohexa-1,5-dien-1-yl(piperidin-1-yl)methanimine?
The InChIKey is MWIOFDBNPXRPDZ-OUKQBFOZSA-N. The full InChI is InChI=1S/C12H18N2/c13-12(11-7-3-1-4-8-11)14-9-5-2-6-10-14/h3,7-8,13H,1-2,4-6,9-10H2/b13-12+.
What are the key properties of cyclohexa-1,5-dien-1-yl(piperidin-1-yl)methanimine?
cyclohexa-1,5-dien-1-yl(piperidin-1-yl)methanimine has a molecular weight of 190.29 g/mol, XLogP of 2.73, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-1,5-dien-1-yl(piperidin-1-yl)methanimine is sourced from PubChem (CID 173151829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).