About 3-amino-1-methyl-7,8-dihydropurin-2-one
3-amino-1-methyl-7,8-dihydropurin-2-one (PubChem CID 173152077) has the molecular formula C6H9N5O
and a molecular weight of 167.17 g/mol. Its IUPAC name is 3-amino-1-methyl-7,8-dihydropurin-2-one.
Molecular Properties
| Compound Name | 3-amino-1-methyl-7,8-dihydropurin-2-one |
| PubChem CID | 173152077 |
| Molecular Formula | C6H9N5O |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | 3-amino-1-methyl-7,8-dihydropurin-2-one |
| SMILES | CN1C=C2NCN=C2N(N)C1=O |
| InChI | InChI=1S/C6H9N5O/c1-10-2-4-5(9-3-8-4)11(7)6(10)12/h2,8H,3,7H2,1H3 |
| InChIKey | WZIYQECQIILSEX-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-1-methyl-7,8-dihydropurin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-methyl-7,8-dihydropurin-2-one?
The IUPAC name of 3-amino-1-methyl-7,8-dihydropurin-2-one (CID 173152077) is 3-amino-1-methyl-7,8-dihydropurin-2-one.
What is the SMILES notation for 3-amino-1-methyl-7,8-dihydropurin-2-one?
The canonical SMILES for 3-amino-1-methyl-7,8-dihydropurin-2-one is CN1C=C2NCN=C2N(N)C1=O.
What is the InChIKey of 3-amino-1-methyl-7,8-dihydropurin-2-one?
The InChIKey is WZIYQECQIILSEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N5O/c1-10-2-4-5(9-3-8-4)11(7)6(10)12/h2,8H,3,7H2,1H3.
What are the key properties of 3-amino-1-methyl-7,8-dihydropurin-2-one?
3-amino-1-methyl-7,8-dihydropurin-2-one has a molecular weight of 167.17 g/mol, XLogP of -0.97, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-methyl-7,8-dihydropurin-2-one is sourced from PubChem (CID 173152077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).