C20H35ClFNO3SSi — CID 173152790
tert-butyl-[[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(3-chloro-5-fluorophenyl)-4-hydroxybutan-2-yl]amino]-oxidosulfanium (PubChem CID 173152790) has the molecular formula C20H35ClFNO3SSi and a molecular weight of 452.11 g/mol. Its IUPAC name is tert-butyl-[[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(3-chloro-5-fluorophenyl)-4-hydroxybutan-2-yl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(3-chloro-5-fluorophenyl)-4-hydroxybutan-2-yl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 173152790 |
| Molecular Formula | C20H35ClFNO3SSi |
| Molecular Weight | 452.11 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | tert-butyl-[[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(3-chloro-5-fluorophenyl)-4-hydroxybutan-2-yl]amino]-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])N[C@@](C)(c1cc(F)cc(Cl)c1)[C@@H](CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H35ClFNO3SSi/c1-18(2,3)27(25)23-20(7,14-10-15(21)12-16(22)11-14)17(13-24)26-28(8,9)19(4,5)6/h10-12,17,23-24H,13H2,1-9H3/t17-,20+,27?/m1/s1 |
| InChIKey | KQJLBHDOEUNFQP-GYAZLVIPSA-N |
| XLogP | 5.13 |
| TPSA | 64.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.11 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|