About 2-methylnonadecoxysilane
2-methylnonadecoxysilane (PubChem CID 173152930) has the molecular formula C20H44OSi
and a molecular weight of 328.66 g/mol. Its IUPAC name is 2-methylnonadecoxysilane.
Molecular Properties
| Compound Name | 2-methylnonadecoxysilane |
| PubChem CID | 173152930 |
| Molecular Formula | C20H44OSi |
| Molecular Weight | 328.66 g/mol |
| Exact Mass | 328.32 |
| IUPAC Name | 2-methylnonadecoxysilane |
| SMILES | CCCCCCCCCCCCCCCCCC(C)CO[SiH3] |
| InChI | InChI=1S/C20H44OSi/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20(2)19-21-22/h20H,3-19H2,1-2,22H3 |
| InChIKey | BMGXEQKYRLGKDK-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.66 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-methylnonadecoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylnonadecoxysilane?
The IUPAC name of 2-methylnonadecoxysilane (CID 173152930) is 2-methylnonadecoxysilane.
What is the SMILES notation for 2-methylnonadecoxysilane?
The canonical SMILES for 2-methylnonadecoxysilane is CCCCCCCCCCCCCCCCCC(C)CO[SiH3].
What is the InChIKey of 2-methylnonadecoxysilane?
The InChIKey is BMGXEQKYRLGKDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H44OSi/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20(2)19-21-22/h20H,3-19H2,1-2,22H3.
What are the key properties of 2-methylnonadecoxysilane?
2-methylnonadecoxysilane has a molecular weight of 328.66 g/mol, XLogP of 6.18, 18 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylnonadecoxysilane is sourced from PubChem (CID 173152930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).