About tert-butyl-[(3R)-4,4-difluoro-1-tributylstannyloct-1-en-3-yl]oxy-dimethylsilane
tert-butyl-[(3R)-4,4-difluoro-1-tributylstannyloct-1-en-3-yl]oxy-dimethylsilane (PubChem CID 173152997) has the molecular formula C26H54F2OSiSn
and a molecular weight of 567.51 g/mol. Its IUPAC name is tert-butyl-[(3R)-4,4-difluoro-1-tributylstannyloct-1-en-3-yl]oxy-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(3R)-4,4-difluoro-1-tributylstannyloct-1-en-3-yl]oxy-dimethylsilane |
| PubChem CID | 173152997 |
| Molecular Formula | C26H54F2OSiSn |
| Molecular Weight | 567.51 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | tert-butyl-[(3R)-4,4-difluoro-1-tributylstannyloct-1-en-3-yl]oxy-dimethylsilane |
| SMILES | CCCCC(F)(F)[C@@H](C=C[Sn](CCCC)(CCCC)CCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H27F2OSi.3C4H9.Sn/c1-8-10-11-14(15,16)12(9-2)17-18(6,7)13(3,4)5;3*1-3-4-2;/h2,9,12H,8,10-11H2,1,3-7H3;3*1,3-4H2,2H3;/t12-;;;;/m1..../s1 |
| InChIKey | RWIPOWXECPFPKK-HHUWXINPSA-N |
| XLogP | 10.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 567.51 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(3R)-4,4-difluoro-1-tributylstannyloct-1-en-3-yl]oxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(3R)-4,4-difluoro-1-tributylstannyloct-1-en-3-yl]oxy-dimethylsilane?
The IUPAC name of tert-butyl-[(3R)-4,4-difluoro-1-tributylstannyloct-1-en-3-yl]oxy-dimethylsilane (CID 173152997) is tert-butyl-[(3R)-4,4-difluoro-1-tributylstannyloct-1-en-3-yl]oxy-dimethylsilane.
What is the SMILES notation for tert-butyl-[(3R)-4,4-difluoro-1-tributylstannyloct-1-en-3-yl]oxy-dimethylsilane?
The canonical SMILES for tert-butyl-[(3R)-4,4-difluoro-1-tributylstannyloct-1-en-3-yl]oxy-dimethylsilane is CCCCC(F)(F)[C@@H](C=C[Sn](CCCC)(CCCC)CCCC)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-[(3R)-4,4-difluoro-1-tributylstannyloct-1-en-3-yl]oxy-dimethylsilane?
The InChIKey is RWIPOWXECPFPKK-HHUWXINPSA-N. The full InChI is InChI=1S/C14H27F2OSi.3C4H9.Sn/c1-8-10-11-14(15,16)12(9-2)17-18(6,7)13(3,4)5;3*1-3-4-2;/h2,9,12H,8,10-11H2,1,3-7H3;3*1,3-4H2,2H3;/t12-;;;;/m1..../s1.
What are the key properties of tert-butyl-[(3R)-4,4-difluoro-1-tributylstannyloct-1-en-3-yl]oxy-dimethylsilane?
tert-butyl-[(3R)-4,4-difluoro-1-tributylstannyloct-1-en-3-yl]oxy-dimethylsilane has a molecular weight of 567.51 g/mol, XLogP of 10.15, 17 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(3R)-4,4-difluoro-1-tributylstannyloct-1-en-3-yl]oxy-dimethylsilane is sourced from PubChem (CID 173152997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).