C11H15NO — CID 173153154
(4aS,9aR)-2,3,4,4a,8,9,9a,9b-octahydroindeno[1,2-b][1,4]oxazine (PubChem CID 173153154) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is (4aS,9aR)-2,3,4,4a,8,9,9a,9b-octahydroindeno[1,2-b][1,4]oxazine.
| Compound Name | (4aS,9aR)-2,3,4,4a,8,9,9a,9b-octahydroindeno[1,2-b][1,4]oxazine |
|---|---|
| PubChem CID | 173153154 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (4aS,9aR)-2,3,4,4a,8,9,9a,9b-octahydroindeno[1,2-b][1,4]oxazine |
| SMILES | C1=CC2=C[C@@H]3NCCOC3[C@@H]2CC1 |
| InChI | InChI=1S/C11H15NO/c1-2-4-9-8(3-1)7-10-11(9)13-6-5-12-10/h1,3,7,9-12H,2,4-6H2/t9-,10+,11?/m1/s1 |
| InChIKey | PGGGHSUOYHGJJG-JKIOLJMWSA-N |
| XLogP | 1.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |