C20H18AsF3N4OS — CID 173153922
5-[2-[(2S)-2-amino-3-[4-(trifluoromethyl)phenyl]propyl]arsanyl-1,3-thiazol-5-yl]-1,2-benzoxazol-3-amine (PubChem CID 173153922) has the molecular formula C20H18AsF3N4OS and a molecular weight of 494.37 g/mol. Its IUPAC name is 5-[2-[(2S)-2-amino-3-[4-(trifluoromethyl)phenyl]propyl]arsanyl-1,3-thiazol-5-yl]-1,2-benzoxazol-3-amine.
| Compound Name | 5-[2-[(2S)-2-amino-3-[4-(trifluoromethyl)phenyl]propyl]arsanyl-1,3-thiazol-5-yl]-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 173153922 |
| Molecular Formula | C20H18AsF3N4OS |
| Molecular Weight | 494.37 g/mol |
| Exact Mass | 494.04 |
| IUPAC Name | 5-[2-[(2S)-2-amino-3-[4-(trifluoromethyl)phenyl]propyl]arsanyl-1,3-thiazol-5-yl]-1,2-benzoxazol-3-amine |
| SMILES | Nc1noc2ccc(-c3cnc([AsH]C[C@@H](N)Cc4ccc(C(F)(F)F)cc4)s3)cc12 |
| InChI | InChI=1S/C20H18AsF3N4OS/c22-20(23,24)13-4-1-11(2-5-13)7-14(25)9-21-19-27-10-17(30-19)12-3-6-16-15(8-12)18(26)28-29-16/h1-6,8,10,14,21H,7,9,25H2,(H2,26,28)/t14-/m0/s1 |
| InChIKey | SKJAIYWKFLSVFZ-AWEZNQCLSA-N |
| XLogP | 3.60 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|