C29H32F2N7O3S+ — CID 173154022
1-[2-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,5-difluorophenyl)-2-hydroxybutyl]-1H-1,2,4-triazol-2-ium-5-yl]ethyl N-[2-(methylamino)propyl]carbamate (PubChem CID 173154022) has the molecular formula C29H32F2N7O3S+ and a molecular weight of 596.68 g/mol. Its IUPAC name is 1-[2-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,5-difluorophenyl)-2-hydroxybutyl]-1H-1,2,4-triazol-2-ium-5-yl]ethyl N-[2-(methylamino)propyl]carbamate.
| Compound Name | 1-[2-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,5-difluorophenyl)-2-hydroxybutyl]-1H-1,2,4-triazol-2-ium-5-yl]ethyl N-[2-(methylamino)propyl]carbamate |
|---|---|
| PubChem CID | 173154022 |
| Molecular Formula | C29H32F2N7O3S+ |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | 1-[2-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,5-difluorophenyl)-2-hydroxybutyl]-1H-1,2,4-triazol-2-ium-5-yl]ethyl N-[2-(methylamino)propyl]carbamate |
| SMILES | CNC(C)CNC(=O)OC(C)c1nc[n+](C[C@](O)(c2cc(F)ccc2F)[C@@H](C)c2nc(-c3ccc(C#N)cc3)cs2)[nH]1 |
| InChI | InChI=1S/C29H31F2N7O3S/c1-17(33-4)13-34-28(39)41-19(3)26-35-16-38(37-26)15-29(40,23-11-22(30)9-10-24(23)31)18(2)27-36-25(14-42-27)21-7-5-20(12-32)6-8-21/h5-11,14,16-19,33,40H,13,15H2,1-4H3,(H,34,39)/p+1/t17?,18-,19?,29+/m0/s1 |
| InChIKey | MYXQYQGIPLYHMI-LTDMZKKRSA-O |
| XLogP | 4.06 |
| TPSA | 139.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|