About potassium;oxido(dioxo)niobium;phosphoric acid
potassium;oxido(dioxo)niobium;phosphoric acid (PubChem CID 173154424) has the molecular formula H3KNbO7P
and a molecular weight of 278.00 g/mol. Its IUPAC name is potassium;oxido(dioxo)niobium;phosphoric acid.
Molecular Properties
| Compound Name | potassium;oxido(dioxo)niobium;phosphoric acid |
| PubChem CID | 173154424 |
| Molecular Formula | H3KNbO7P |
| Molecular Weight | 278.00 g/mol |
| Exact Mass | 277.83 |
| IUPAC Name | potassium;oxido(dioxo)niobium;phosphoric acid |
| SMILES | O=P(O)(O)O.O=[Nb](=O)[O-].[K+] |
| InChI | InChI=1S/K.Nb.H3O4P.3O/c;;1-5(2,3)4;;;/h;;(H3,1,2,3,4);;;/q+1;;;;;-1 |
| InChIKey | NFVVKKAXVHMHSJ-UHFFFAOYSA-N |
| XLogP | -5.35 |
| TPSA | 134.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.00 |
| LogP ≤ 5 | -5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze potassium;oxido(dioxo)niobium;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;oxido(dioxo)niobium;phosphoric acid?
The IUPAC name of potassium;oxido(dioxo)niobium;phosphoric acid (CID 173154424) is potassium;oxido(dioxo)niobium;phosphoric acid.
What is the SMILES notation for potassium;oxido(dioxo)niobium;phosphoric acid?
The canonical SMILES for potassium;oxido(dioxo)niobium;phosphoric acid is O=P(O)(O)O.O=[Nb](=O)[O-].[K+].
What is the InChIKey of potassium;oxido(dioxo)niobium;phosphoric acid?
The InChIKey is NFVVKKAXVHMHSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/K.Nb.H3O4P.3O/c;;1-5(2,3)4;;;/h;;(H3,1,2,3,4);;;/q+1;;;;;-1.
What are the key properties of potassium;oxido(dioxo)niobium;phosphoric acid?
potassium;oxido(dioxo)niobium;phosphoric acid has a molecular weight of 278.00 g/mol, XLogP of -5.35, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;oxido(dioxo)niobium;phosphoric acid is sourced from PubChem (CID 173154424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).