C32H52IN3Se — CID 173154937
3-N,3-N,7-N,7-N-tetrapentyl-10H-phenoselenazine-3,7-diamine;hydroiodide (PubChem CID 173154937) has the molecular formula C32H52IN3Se and a molecular weight of 684.65 g/mol. Its IUPAC name is 3-N,3-N,7-N,7-N-tetrapentyl-10H-phenoselenazine-3,7-diamine;hydroiodide.
| Compound Name | 3-N,3-N,7-N,7-N-tetrapentyl-10H-phenoselenazine-3,7-diamine;hydroiodide |
|---|---|
| PubChem CID | 173154937 |
| Molecular Formula | C32H52IN3Se |
| Molecular Weight | 684.65 g/mol |
| Exact Mass | 685.24 |
| IUPAC Name | 3-N,3-N,7-N,7-N-tetrapentyl-10H-phenoselenazine-3,7-diamine;hydroiodide |
| SMILES | CCCCCN(CCCCC)c1ccc2c(c1)[Se]c1cc(N(CCCCC)CCCCC)ccc1N2.I |
| InChI | InChI=1S/C32H51N3Se.HI/c1-5-9-13-21-34(22-14-10-6-2)27-17-19-29-31(25-27)36-32-26-28(18-20-30(32)33-29)35(23-15-11-7-3)24-16-12-8-4;/h17-20,25-26,33H,5-16,21-24H2,1-4H3;1H |
| InChIKey | YAJSVUPQHLRDEJ-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.65 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|