C6H4Br4 — CID 173155063
1,2,3,4-tetrabromocyclohexa-1,4-diene (PubChem CID 173155063) has the molecular formula C6H4Br4 and a molecular weight of 395.71 g/mol. Its IUPAC name is 1,2,3,4-tetrabromocyclohexa-1,4-diene.
| Compound Name | 1,2,3,4-tetrabromocyclohexa-1,4-diene |
|---|---|
| PubChem CID | 173155063 |
| Molecular Formula | C6H4Br4 |
| Molecular Weight | 395.71 g/mol |
| Exact Mass | 391.70 |
| IUPAC Name | 1,2,3,4-tetrabromocyclohexa-1,4-diene |
| SMILES | BrC1=CCC(Br)=C(Br)C1Br |
| InChI | InChI=1S/C6H4Br4/c7-3-1-2-4(8)6(10)5(3)9/h1,5H,2H2 |
| InChIKey | RRAAQNPCBNQHDP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.71 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|