About cyclopropanamine;triethoxysilane
cyclopropanamine;triethoxysilane (PubChem CID 173155848) has the molecular formula C9H23NO3Si
and a molecular weight of 221.37 g/mol. Its IUPAC name is cyclopropanamine;triethoxysilane.
Molecular Properties
| Compound Name | cyclopropanamine;triethoxysilane |
| PubChem CID | 173155848 |
| Molecular Formula | C9H23NO3Si |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | cyclopropanamine;triethoxysilane |
| SMILES | CCO[SiH](OCC)OCC.NC1CC1 |
| InChI | InChI=1S/C6H16O3Si.C3H7N/c1-4-7-10(8-5-2)9-6-3;4-3-1-2-3/h10H,4-6H2,1-3H3;3H,1-2,4H2 |
| InChIKey | ISTJSXRZFQAAGB-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclopropanamine;triethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropanamine;triethoxysilane?
The IUPAC name of cyclopropanamine;triethoxysilane (CID 173155848) is cyclopropanamine;triethoxysilane.
What is the SMILES notation for cyclopropanamine;triethoxysilane?
The canonical SMILES for cyclopropanamine;triethoxysilane is CCO[SiH](OCC)OCC.NC1CC1.
What is the InChIKey of cyclopropanamine;triethoxysilane?
The InChIKey is ISTJSXRZFQAAGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16O3Si.C3H7N/c1-4-7-10(8-5-2)9-6-3;4-3-1-2-3/h10H,4-6H2,1-3H3;3H,1-2,4H2.
What are the key properties of cyclopropanamine;triethoxysilane?
cyclopropanamine;triethoxysilane has a molecular weight of 221.37 g/mol, XLogP of 0.92, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropanamine;triethoxysilane is sourced from PubChem (CID 173155848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).